C11H18N6O2S — CID 106327542
2-N-methyl-5-nitro-4-N-(2-thiomorpholin-4-ylethyl)pyrimidine-2,4-diamine (PubChem CID 106327542) has the molecular formula C11H18N6O2S and a molecular weight of 298.37 g/mol. Its IUPAC name is 2-N-methyl-5-nitro-4-N-(2-thiomorpholin-4-ylethyl)pyrimidine-2,4-diamine.
| Compound Name | 2-N-methyl-5-nitro-4-N-(2-thiomorpholin-4-ylethyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 106327542 |
| Molecular Formula | C11H18N6O2S |
| Molecular Weight | 298.37 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | 2-N-methyl-5-nitro-4-N-(2-thiomorpholin-4-ylethyl)pyrimidine-2,4-diamine |
| SMILES | CNc1ncc([N+](=O)[O-])c(NCCN2CCSCC2)n1 |
| InChI | InChI=1S/C11H18N6O2S/c1-12-11-14-8-9(17(18)19)10(15-11)13-2-3-16-4-6-20-7-5-16/h8H,2-7H2,1H3,(H2,12,13,14,15) |
| InChIKey | SWFAKEXNLKLWJX-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.37 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|