C12H25N5S — CID 106327693
1-amino-3-cyclopentyl-2-(2-thiomorpholin-4-ylethyl)guanidine (PubChem CID 106327693) has the molecular formula C12H25N5S and a molecular weight of 271.43 g/mol. Its IUPAC name is 1-amino-3-cyclopentyl-2-(2-thiomorpholin-4-ylethyl)guanidine.
| Compound Name | 1-amino-3-cyclopentyl-2-(2-thiomorpholin-4-ylethyl)guanidine |
|---|---|
| PubChem CID | 106327693 |
| Molecular Formula | C12H25N5S |
| Molecular Weight | 271.43 g/mol |
| Exact Mass | 271.18 |
| IUPAC Name | 1-amino-3-cyclopentyl-2-(2-thiomorpholin-4-ylethyl)guanidine |
| SMILES | NN/C(=N\CCN1CCSCC1)NC1CCCC1 |
| InChI | InChI=1S/C12H25N5S/c13-16-12(15-11-3-1-2-4-11)14-5-6-17-7-9-18-10-8-17/h11H,1-10,13H2,(H2,14,15,16) |
| InChIKey | DEXPJNRUGSIXNZ-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 65.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.43 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|