About N-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-3-methylpentan-3-amine
N-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-3-methylpentan-3-amine (PubChem CID 106328145) has the molecular formula C12H23N3
and a molecular weight of 209.34 g/mol. Its IUPAC name is N-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-3-methylpentan-3-amine.
Molecular Properties
| Compound Name | N-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-3-methylpentan-3-amine |
| PubChem CID | 106328145 |
| Molecular Formula | C12H23N3 |
| Molecular Weight | 209.34 g/mol |
| Exact Mass | 209.19 |
| IUPAC Name | N-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-3-methylpentan-3-amine |
| SMILES | CCC(C)(CC)NCc1c(C)n[nH]c1C |
| InChI | InChI=1S/C12H23N3/c1-6-12(5,7-2)13-8-11-9(3)14-15-10(11)4/h13H,6-8H2,1-5H3,(H,14,15) |
| InChIKey | QKSLLSNNCHGTAE-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.34 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-3-methylpentan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-3-methylpentan-3-amine?
The IUPAC name of N-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-3-methylpentan-3-amine (CID 106328145) is N-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-3-methylpentan-3-amine.
What is the SMILES notation for N-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-3-methylpentan-3-amine?
The canonical SMILES for N-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-3-methylpentan-3-amine is CCC(C)(CC)NCc1c(C)n[nH]c1C.
What is the InChIKey of N-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-3-methylpentan-3-amine?
The InChIKey is QKSLLSNNCHGTAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23N3/c1-6-12(5,7-2)13-8-11-9(3)14-15-10(11)4/h13H,6-8H2,1-5H3,(H,14,15).
What are the key properties of N-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-3-methylpentan-3-amine?
N-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-3-methylpentan-3-amine has a molecular weight of 209.34 g/mol, XLogP of 2.69, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-3-methylpentan-3-amine is sourced from PubChem (CID 106328145), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).