C14H25NO — CID 10632875
(1S,3Z,9aS)-1-methyl-3-(2-methylpropylidene)-4,6,7,8,9,9a-hexahydro-2H-quinolizin-1-ol (PubChem CID 10632875) has the molecular formula C14H25NO and a molecular weight of 223.36 g/mol. Its IUPAC name is (1S,3Z,9aS)-1-methyl-3-(2-methylpropylidene)-4,6,7,8,9,9a-hexahydro-2H-quinolizin-1-ol.
| Compound Name | (1S,3Z,9aS)-1-methyl-3-(2-methylpropylidene)-4,6,7,8,9,9a-hexahydro-2H-quinolizin-1-ol |
|---|---|
| PubChem CID | 10632875 |
| Molecular Formula | C14H25NO |
| Molecular Weight | 223.36 g/mol |
| Exact Mass | 223.19 |
| IUPAC Name | (1S,3Z,9aS)-1-methyl-3-(2-methylpropylidene)-4,6,7,8,9,9a-hexahydro-2H-quinolizin-1-ol |
| SMILES | CC(C)/C=C1\CN2CCCC[C@H]2[C@@](C)(O)C1 |
| InChI | InChI=1S/C14H25NO/c1-11(2)8-12-9-14(3,16)13-6-4-5-7-15(13)10-12/h8,11,13,16H,4-7,9-10H2,1-3H3/b12-8-/t13-,14-/m0/s1 |
| InChIKey | IDHCJVREQNIIJH-KGKULNKVSA-N |
| XLogP | 2.58 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.36 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|