C12H25NO — CID 106328921
trans-(1S,2S)-2-(3-methylpentan-3-ylamino)cyclohexan-1-ol (PubChem CID 106328921) has the molecular formula C12H25NO and a molecular weight of 199.34 g/mol. Its IUPAC name is trans-(1S,2S)-2-(3-methylpentan-3-ylamino)cyclohexan-1-ol.
| Compound Name | trans-(1S,2S)-2-(3-methylpentan-3-ylamino)cyclohexan-1-ol |
|---|---|
| PubChem CID | 106328921 |
| Molecular Formula | C12H25NO |
| Molecular Weight | 199.34 g/mol |
| Exact Mass | 199.19 |
| IUPAC Name | trans-(1S,2S)-2-(3-methylpentan-3-ylamino)cyclohexan-1-ol |
| SMILES | CCC(C)(CC)N[C@H]1CCCC[C@@H]1O |
| InChI | InChI=1S/C12H25NO/c1-4-12(3,5-2)13-10-8-6-7-9-11(10)14/h10-11,13-14H,4-9H2,1-3H3/t10-,11-/m0/s1 |
| InChIKey | SRQHXKTVZGPIRB-QWRGUYRKSA-N |
| XLogP | 2.46 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.34 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |