About 3-ethylphenoxathiine
3-ethylphenoxathiine (PubChem CID 10633121) has the molecular formula C14H12OS
and a molecular weight of 228.32 g/mol. Its IUPAC name is 3-ethylphenoxathiine.
Molecular Properties
| Compound Name | 3-ethylphenoxathiine |
| PubChem CID | 10633121 |
| Molecular Formula | C14H12OS |
| Molecular Weight | 228.32 g/mol |
| Exact Mass | 228.06 |
| IUPAC Name | 3-ethylphenoxathiine |
| SMILES | CCc1ccc2c(c1)Oc1ccccc1S2 |
| InChI | InChI=1S/C14H12OS/c1-2-10-7-8-14-12(9-10)15-11-5-3-4-6-13(11)16-14/h3-9H,2H2,1H3 |
| InChIKey | LVTVHKBJJQEETH-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.32 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-ethylphenoxathiine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethylphenoxathiine?
The IUPAC name of 3-ethylphenoxathiine (CID 10633121) is 3-ethylphenoxathiine.
What is the SMILES notation for 3-ethylphenoxathiine?
The canonical SMILES for 3-ethylphenoxathiine is CCc1ccc2c(c1)Oc1ccccc1S2.
What is the InChIKey of 3-ethylphenoxathiine?
The InChIKey is LVTVHKBJJQEETH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12OS/c1-2-10-7-8-14-12(9-10)15-11-5-3-4-6-13(11)16-14/h3-9H,2H2,1H3.
What are the key properties of 3-ethylphenoxathiine?
3-ethylphenoxathiine has a molecular weight of 228.32 g/mol, XLogP of 4.51, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethylphenoxathiine is sourced from PubChem (CID 10633121), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).