C10H22N2O3S — CID 106333827
2-[(2,2-dimethyloxan-4-yl)amino]-N-methylethanesulfonamide (PubChem CID 106333827) has the molecular formula C10H22N2O3S and a molecular weight of 250.36 g/mol. Its IUPAC name is 2-[(2,2-dimethyloxan-4-yl)amino]-N-methylethanesulfonamide.
| Compound Name | 2-[(2,2-dimethyloxan-4-yl)amino]-N-methylethanesulfonamide |
|---|---|
| PubChem CID | 106333827 |
| Molecular Formula | C10H22N2O3S |
| Molecular Weight | 250.36 g/mol |
| Exact Mass | 250.14 |
| IUPAC Name | 2-[(2,2-dimethyloxan-4-yl)amino]-N-methylethanesulfonamide |
| SMILES | CNS(=O)(=O)CCNC1CCOC(C)(C)C1 |
| InChI | InChI=1S/C10H22N2O3S/c1-10(2)8-9(4-6-15-10)12-5-7-16(13,14)11-3/h9,11-12H,4-8H2,1-3H3 |
| InChIKey | FLKNTIDVVRAQIH-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.36 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |