C11H24N2O2S2 — CID 106334525
2-[(5,5-dimethylthian-3-yl)amino]-N-ethylethanesulfonamide (PubChem CID 106334525) has the molecular formula C11H24N2O2S2 and a molecular weight of 280.46 g/mol. Its IUPAC name is 2-[(5,5-dimethylthian-3-yl)amino]-N-ethylethanesulfonamide.
| Compound Name | 2-[(5,5-dimethylthian-3-yl)amino]-N-ethylethanesulfonamide |
|---|---|
| PubChem CID | 106334525 |
| Molecular Formula | C11H24N2O2S2 |
| Molecular Weight | 280.46 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | 2-[(5,5-dimethylthian-3-yl)amino]-N-ethylethanesulfonamide |
| SMILES | CCNS(=O)(=O)CCNC1CSCC(C)(C)C1 |
| InChI | InChI=1S/C11H24N2O2S2/c1-4-13-17(14,15)6-5-12-10-7-11(2,3)9-16-8-10/h10,12-13H,4-9H2,1-3H3 |
| InChIKey | WINATVKGCVAIMR-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.46 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |