C11H21F3N2O2S — CID 106334678
N-ethyl-2-[[2-(trifluoromethyl)cyclohexyl]amino]ethanesulfonamide (PubChem CID 106334678) has the molecular formula C11H21F3N2O2S and a molecular weight of 302.36 g/mol. Its IUPAC name is N-ethyl-2-[[2-(trifluoromethyl)cyclohexyl]amino]ethanesulfonamide.
| Compound Name | N-ethyl-2-[[2-(trifluoromethyl)cyclohexyl]amino]ethanesulfonamide |
|---|---|
| PubChem CID | 106334678 |
| Molecular Formula | C11H21F3N2O2S |
| Molecular Weight | 302.36 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | N-ethyl-2-[[2-(trifluoromethyl)cyclohexyl]amino]ethanesulfonamide |
| SMILES | CCNS(=O)(=O)CCNC1CCCCC1C(F)(F)F |
| InChI | InChI=1S/C11H21F3N2O2S/c1-2-16-19(17,18)8-7-15-10-6-4-3-5-9(10)11(12,13)14/h9-10,15-16H,2-8H2,1H3 |
| InChIKey | NRFHVUASMHCVPI-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.36 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |