C15H22O2 — CID 10633470
8-[(1E)-buta-1,3-dienyl]-7,9,9-trimethyl-1,4-dioxaspiro[4.5]dec-6-ene (PubChem CID 10633470) has the molecular formula C15H22O2 and a molecular weight of 234.34 g/mol. Its IUPAC name is 8-[(1E)-buta-1,3-dienyl]-7,9,9-trimethyl-1,4-dioxaspiro[4.5]dec-6-ene.
| Compound Name | 8-[(1E)-buta-1,3-dienyl]-7,9,9-trimethyl-1,4-dioxaspiro[4.5]dec-6-ene |
|---|---|
| PubChem CID | 10633470 |
| Molecular Formula | C15H22O2 |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.16 |
| IUPAC Name | 8-[(1E)-buta-1,3-dienyl]-7,9,9-trimethyl-1,4-dioxaspiro[4.5]dec-6-ene |
| SMILES | C=C/C=C/C1C(C)=CC2(CC1(C)C)OCCO2 |
| InChI | InChI=1S/C15H22O2/c1-5-6-7-13-12(2)10-15(11-14(13,3)4)16-8-9-17-15/h5-7,10,13H,1,8-9,11H2,2-4H3/b7-6+ |
| InChIKey | NUHUJSPYUSDXLD-VOTSOKGWSA-N |
| XLogP | 3.46 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|