C15H22O2 — CID 10633479
(3aR,4S,5S,8aR)-5-(3-hydroxyprop-1-en-2-yl)-3,8-dimethylidene-1,2,3a,4,5,6,7,8a-octahydroazulen-4-ol (PubChem CID 10633479) has the molecular formula C15H22O2 and a molecular weight of 234.34 g/mol. Its IUPAC name is (3aR,4S,5S,8aR)-5-(3-hydroxyprop-1-en-2-yl)-3,8-dimethylidene-1,2,3a,4,5,6,7,8a-octahydroazulen-4-ol.
| Compound Name | (3aR,4S,5S,8aR)-5-(3-hydroxyprop-1-en-2-yl)-3,8-dimethylidene-1,2,3a,4,5,6,7,8a-octahydroazulen-4-ol |
|---|---|
| PubChem CID | 10633479 |
| Molecular Formula | C15H22O2 |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.16 |
| IUPAC Name | (3aR,4S,5S,8aR)-5-(3-hydroxyprop-1-en-2-yl)-3,8-dimethylidene-1,2,3a,4,5,6,7,8a-octahydroazulen-4-ol |
| SMILES | C=C1CC[C@H]2C(=C)CC[C@@H](C(=C)CO)[C@H](O)[C@@H]12 |
| InChI | InChI=1S/C15H22O2/c1-9-4-7-13(11(3)8-16)15(17)14-10(2)5-6-12(9)14/h12-17H,1-8H2/t12-,13-,14-,15-/m0/s1 |
| InChIKey | WKISBWAEMCVJQO-AJNGGQMLSA-N |
| XLogP | 2.44 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|