C14H21NO2 — CID 10633526
2-(methoxymethyl)-2,4,6,7-tetramethyl-3H-1-benzofuran-5-amine (PubChem CID 10633526) has the molecular formula C14H21NO2 and a molecular weight of 235.33 g/mol. Its IUPAC name is 2-(methoxymethyl)-2,4,6,7-tetramethyl-3H-1-benzofuran-5-amine.
| Compound Name | 2-(methoxymethyl)-2,4,6,7-tetramethyl-3H-1-benzofuran-5-amine |
|---|---|
| PubChem CID | 10633526 |
| Molecular Formula | C14H21NO2 |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.16 |
| IUPAC Name | 2-(methoxymethyl)-2,4,6,7-tetramethyl-3H-1-benzofuran-5-amine |
| SMILES | COCC1(C)Cc2c(C)c(N)c(C)c(C)c2O1 |
| InChI | InChI=1S/C14H21NO2/c1-8-9(2)13-11(10(3)12(8)15)6-14(4,17-13)7-16-5/h6-7,15H2,1-5H3 |
| InChIKey | YGBPWCHWOUYRMI-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|