C10H22N2O3S — CID 106335406
N,N-dimethyl-2-(oxan-4-ylmethylamino)ethanesulfonamide (PubChem CID 106335406) has the molecular formula C10H22N2O3S and a molecular weight of 250.36 g/mol. Its IUPAC name is N,N-dimethyl-2-(oxan-4-ylmethylamino)ethanesulfonamide.
| Compound Name | N,N-dimethyl-2-(oxan-4-ylmethylamino)ethanesulfonamide |
|---|---|
| PubChem CID | 106335406 |
| Molecular Formula | C10H22N2O3S |
| Molecular Weight | 250.36 g/mol |
| Exact Mass | 250.14 |
| IUPAC Name | N,N-dimethyl-2-(oxan-4-ylmethylamino)ethanesulfonamide |
| SMILES | CN(C)S(=O)(=O)CCNCC1CCOCC1 |
| InChI | InChI=1S/C10H22N2O3S/c1-12(2)16(13,14)8-5-11-9-10-3-6-15-7-4-10/h10-11H,3-9H2,1-2H3 |
| InChIKey | KPNNDYNODOGELW-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.36 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|