C11H19N3O4S2 — CID 106335853
2-[[2-(aminomethyl)phenyl]methylsulfonylamino]-N-methylethanesulfonamide (PubChem CID 106335853) has the molecular formula C11H19N3O4S2 and a molecular weight of 321.42 g/mol. Its IUPAC name is 2-[[2-(aminomethyl)phenyl]methylsulfonylamino]-N-methylethanesulfonamide.
| Compound Name | 2-[[2-(aminomethyl)phenyl]methylsulfonylamino]-N-methylethanesulfonamide |
|---|---|
| PubChem CID | 106335853 |
| Molecular Formula | C11H19N3O4S2 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.08 |
| IUPAC Name | 2-[[2-(aminomethyl)phenyl]methylsulfonylamino]-N-methylethanesulfonamide |
| SMILES | CNS(=O)(=O)CCNS(=O)(=O)Cc1ccccc1CN |
| InChI | InChI=1S/C11H19N3O4S2/c1-13-19(15,16)7-6-14-20(17,18)9-11-5-3-2-4-10(11)8-12/h2-5,13-14H,6-9,12H2,1H3 |
| InChIKey | FGPMXGCCSPPNCP-UHFFFAOYSA-N |
| XLogP | -0.89 |
| TPSA | 118.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |