C15H24O2 — CID 10633589
(3aS,7aR)-7-cyclohexyl-2,2-dimethyl-3a,4,5,7a-tetrahydro-1,3-benzodioxole (PubChem CID 10633589) has the molecular formula C15H24O2 and a molecular weight of 236.35 g/mol. Its IUPAC name is (3aS,7aR)-7-cyclohexyl-2,2-dimethyl-3a,4,5,7a-tetrahydro-1,3-benzodioxole.
| Compound Name | (3aS,7aR)-7-cyclohexyl-2,2-dimethyl-3a,4,5,7a-tetrahydro-1,3-benzodioxole |
|---|---|
| PubChem CID | 10633589 |
| Molecular Formula | C15H24O2 |
| Molecular Weight | 236.35 g/mol |
| Exact Mass | 236.18 |
| IUPAC Name | (3aS,7aR)-7-cyclohexyl-2,2-dimethyl-3a,4,5,7a-tetrahydro-1,3-benzodioxole |
| SMILES | CC1(C)O[C@H]2CCC=C(C3CCCCC3)[C@H]2O1 |
| InChI | InChI=1S/C15H24O2/c1-15(2)16-13-10-6-9-12(14(13)17-15)11-7-4-3-5-8-11/h9,11,13-14H,3-8,10H2,1-2H3/t13-,14+/m0/s1 |
| InChIKey | AXHXYDNBMPQBMC-UONOGXRCSA-N |
| XLogP | 3.81 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.35 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|