C15H31N3O4S — CID 106336109
tert-butyl 4-[2-(dimethylsulfamoyl)ethylamino]azepane-1-carboxylate (PubChem CID 106336109) has the molecular formula C15H31N3O4S and a molecular weight of 349.50 g/mol. Its IUPAC name is tert-butyl 4-[2-(dimethylsulfamoyl)ethylamino]azepane-1-carboxylate.
| Compound Name | tert-butyl 4-[2-(dimethylsulfamoyl)ethylamino]azepane-1-carboxylate |
|---|---|
| PubChem CID | 106336109 |
| Molecular Formula | C15H31N3O4S |
| Molecular Weight | 349.50 g/mol |
| Exact Mass | 349.20 |
| IUPAC Name | tert-butyl 4-[2-(dimethylsulfamoyl)ethylamino]azepane-1-carboxylate |
| SMILES | CN(C)S(=O)(=O)CCNC1CCCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C15H31N3O4S/c1-15(2,3)22-14(19)18-10-6-7-13(8-11-18)16-9-12-23(20,21)17(4)5/h13,16H,6-12H2,1-5H3 |
| InChIKey | HRIWXTHSXPUMFB-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.50 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |