C9H18F3N3O3S — CID 106336369
2-[3-(methanesulfonamido)propylamino]-N-(2,2,2-trifluoroethyl)propanamide (PubChem CID 106336369) has the molecular formula C9H18F3N3O3S and a molecular weight of 305.32 g/mol. Its IUPAC name is 2-[3-(methanesulfonamido)propylamino]-N-(2,2,2-trifluoroethyl)propanamide.
| Compound Name | 2-[3-(methanesulfonamido)propylamino]-N-(2,2,2-trifluoroethyl)propanamide |
|---|---|
| PubChem CID | 106336369 |
| Molecular Formula | C9H18F3N3O3S |
| Molecular Weight | 305.32 g/mol |
| Exact Mass | 305.10 |
| IUPAC Name | 2-[3-(methanesulfonamido)propylamino]-N-(2,2,2-trifluoroethyl)propanamide |
| SMILES | CC(NCCCNS(C)(=O)=O)C(=O)NCC(F)(F)F |
| InChI | InChI=1S/C9H18F3N3O3S/c1-7(8(16)14-6-9(10,11)12)13-4-3-5-15-19(2,17)18/h7,13,15H,3-6H2,1-2H3,(H,14,16) |
| InChIKey | HZMSXIPNRKBPPD-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.32 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|