C10H13N3O2S2 — CID 106337620
2-(2,1-benzothiazol-3-ylamino)-N-methylethanesulfonamide (PubChem CID 106337620) has the molecular formula C10H13N3O2S2 and a molecular weight of 271.37 g/mol. Its IUPAC name is 2-(2,1-benzothiazol-3-ylamino)-N-methylethanesulfonamide.
| Compound Name | 2-(2,1-benzothiazol-3-ylamino)-N-methylethanesulfonamide |
|---|---|
| PubChem CID | 106337620 |
| Molecular Formula | C10H13N3O2S2 |
| Molecular Weight | 271.37 g/mol |
| Exact Mass | 271.04 |
| IUPAC Name | 2-(2,1-benzothiazol-3-ylamino)-N-methylethanesulfonamide |
| SMILES | CNS(=O)(=O)CCNc1snc2ccccc12 |
| InChI | InChI=1S/C10H13N3O2S2/c1-11-17(14,15)7-6-12-10-8-4-2-3-5-9(8)13-16-10/h2-5,11-12H,6-7H2,1H3 |
| InChIKey | JZZMTTGCVNZRMT-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.37 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |