C12H15N3O3S — CID 106337642
2-cyano-N-[2-(methylsulfamoyl)ethyl]-2-phenylacetamide (PubChem CID 106337642) has the molecular formula C12H15N3O3S and a molecular weight of 281.34 g/mol. Its IUPAC name is 2-cyano-N-[2-(methylsulfamoyl)ethyl]-2-phenylacetamide.
| Compound Name | 2-cyano-N-[2-(methylsulfamoyl)ethyl]-2-phenylacetamide |
|---|---|
| PubChem CID | 106337642 |
| Molecular Formula | C12H15N3O3S |
| Molecular Weight | 281.34 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | 2-cyano-N-[2-(methylsulfamoyl)ethyl]-2-phenylacetamide |
| SMILES | CNS(=O)(=O)CCNC(=O)C(C#N)c1ccccc1 |
| InChI | InChI=1S/C12H15N3O3S/c1-14-19(17,18)8-7-15-12(16)11(9-13)10-5-3-2-4-6-10/h2-6,11,14H,7-8H2,1H3,(H,15,16) |
| InChIKey | HCGLPOUEAWQXAK-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 99.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.34 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |