C13H20O4 — CID 10633792
ethyl (E)-3-[(3S)-1,4-dioxaspiro[4.5]decan-3-yl]prop-2-enoate (PubChem CID 10633792) has the molecular formula C13H20O4 and a molecular weight of 240.30 g/mol. Its IUPAC name is ethyl (E)-3-[(3S)-1,4-dioxaspiro[4.5]decan-3-yl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[(3S)-1,4-dioxaspiro[4.5]decan-3-yl]prop-2-enoate |
|---|---|
| PubChem CID | 10633792 |
| Molecular Formula | C13H20O4 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | ethyl (E)-3-[(3S)-1,4-dioxaspiro[4.5]decan-3-yl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C/[C@H]1COC2(CCCCC2)O1 |
| InChI | InChI=1S/C13H20O4/c1-2-15-12(14)7-6-11-10-16-13(17-11)8-4-3-5-9-13/h6-7,11H,2-5,8-10H2,1H3/b7-6+/t11-/m0/s1 |
| InChIKey | IBMPGUKZRLQGSH-MLRMMBSGSA-N |
| XLogP | 2.18 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|