About N-[3-(6-hydroxy-2,4-dioxopyrimidin-1-yl)propyl]methanesulfonamide
N-[3-(6-hydroxy-2,4-dioxopyrimidin-1-yl)propyl]methanesulfonamide (PubChem CID 106338298) has the molecular formula C8H13N3O5S
and a molecular weight of 263.27 g/mol. Its IUPAC name is N-[3-(6-hydroxy-2,4-dioxopyrimidin-1-yl)propyl]methanesulfonamide.
Molecular Properties
| Compound Name | N-[3-(6-hydroxy-2,4-dioxopyrimidin-1-yl)propyl]methanesulfonamide |
| PubChem CID | 106338298 |
| Molecular Formula | C8H13N3O5S |
| Molecular Weight | 263.27 g/mol |
| Exact Mass | 263.06 |
| IUPAC Name | N-[3-(6-hydroxy-2,4-dioxopyrimidin-1-yl)propyl]methanesulfonamide |
| SMILES | CS(=O)(=O)NCCCn1c(O)cc(=O)[nH]c1=O |
| InChI | InChI=1S/C8H13N3O5S/c1-17(15,16)9-3-2-4-11-7(13)5-6(12)10-8(11)14/h5,9,13H,2-4H2,1H3,(H,10,12,14) |
| InChIKey | NMBGFNDJBHUBLS-UHFFFAOYSA-N |
| XLogP | -1.82 |
| TPSA | 121.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.27 |
| LogP ≤ 5 | -1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[3-(6-hydroxy-2,4-dioxopyrimidin-1-yl)propyl]methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-(6-hydroxy-2,4-dioxopyrimidin-1-yl)propyl]methanesulfonamide?
The IUPAC name of N-[3-(6-hydroxy-2,4-dioxopyrimidin-1-yl)propyl]methanesulfonamide (CID 106338298) is N-[3-(6-hydroxy-2,4-dioxopyrimidin-1-yl)propyl]methanesulfonamide.
What is the SMILES notation for N-[3-(6-hydroxy-2,4-dioxopyrimidin-1-yl)propyl]methanesulfonamide?
The canonical SMILES for N-[3-(6-hydroxy-2,4-dioxopyrimidin-1-yl)propyl]methanesulfonamide is CS(=O)(=O)NCCCn1c(O)cc(=O)[nH]c1=O.
What is the InChIKey of N-[3-(6-hydroxy-2,4-dioxopyrimidin-1-yl)propyl]methanesulfonamide?
The InChIKey is NMBGFNDJBHUBLS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N3O5S/c1-17(15,16)9-3-2-4-11-7(13)5-6(12)10-8(11)14/h5,9,13H,2-4H2,1H3,(H,10,12,14).
What are the key properties of N-[3-(6-hydroxy-2,4-dioxopyrimidin-1-yl)propyl]methanesulfonamide?
N-[3-(6-hydroxy-2,4-dioxopyrimidin-1-yl)propyl]methanesulfonamide has a molecular weight of 263.27 g/mol, XLogP of -1.82, 5 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-(6-hydroxy-2,4-dioxopyrimidin-1-yl)propyl]methanesulfonamide is sourced from PubChem (CID 106338298), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).