C11H17F3N4O2S — CID 106338518
N-[3-[2-(trifluoromethyl)-4,5,6,7-tetrahydroimidazo[4,5-c]pyridin-1-yl]propyl]methanesulfonamide (PubChem CID 106338518) has the molecular formula C11H17F3N4O2S and a molecular weight of 326.34 g/mol. Its IUPAC name is N-[3-[2-(trifluoromethyl)-4,5,6,7-tetrahydroimidazo[4,5-c]pyridin-1-yl]propyl]methanesulfonamide.
| Compound Name | N-[3-[2-(trifluoromethyl)-4,5,6,7-tetrahydroimidazo[4,5-c]pyridin-1-yl]propyl]methanesulfonamide |
|---|---|
| PubChem CID | 106338518 |
| Molecular Formula | C11H17F3N4O2S |
| Molecular Weight | 326.34 g/mol |
| Exact Mass | 326.10 |
| IUPAC Name | N-[3-[2-(trifluoromethyl)-4,5,6,7-tetrahydroimidazo[4,5-c]pyridin-1-yl]propyl]methanesulfonamide |
| SMILES | CS(=O)(=O)NCCCn1c(C(F)(F)F)nc2c1CCNC2 |
| InChI | InChI=1S/C11H17F3N4O2S/c1-21(19,20)16-4-2-6-18-9-3-5-15-7-8(9)17-10(18)11(12,13)14/h15-16H,2-7H2,1H3 |
| InChIKey | HQKKORQLRHXZHF-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.34 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|