C6H12N4O2S3 — CID 106339452
N-[3-[(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)amino]propyl]methanesulfonamide (PubChem CID 106339452) has the molecular formula C6H12N4O2S3 and a molecular weight of 268.39 g/mol. Its IUPAC name is N-[3-[(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)amino]propyl]methanesulfonamide.
| Compound Name | N-[3-[(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)amino]propyl]methanesulfonamide |
|---|---|
| PubChem CID | 106339452 |
| Molecular Formula | C6H12N4O2S3 |
| Molecular Weight | 268.39 g/mol |
| Exact Mass | 268.01 |
| IUPAC Name | N-[3-[(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)amino]propyl]methanesulfonamide |
| SMILES | CS(=O)(=O)NCCCNc1n[nH]c(=S)s1 |
| InChI | InChI=1S/C6H12N4O2S3/c1-15(11,12)8-4-2-3-7-5-9-10-6(13)14-5/h8H,2-4H2,1H3,(H,7,9)(H,10,13) |
| InChIKey | VYLCHMWCFQVYMI-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.39 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|