About [(E)-5-[(2R)-3,3-dimethyloxiran-2-yl]-3-methylpent-2-enoxy]-trimethylsilane
[(E)-5-[(2R)-3,3-dimethyloxiran-2-yl]-3-methylpent-2-enoxy]-trimethylsilane (PubChem CID 10633954) has the molecular formula C13H26O2Si
and a molecular weight of 242.43 g/mol. Its IUPAC name is [(E)-5-[(2R)-3,3-dimethyloxiran-2-yl]-3-methylpent-2-enoxy]-trimethylsilane.
Molecular Properties
| Compound Name | [(E)-5-[(2R)-3,3-dimethyloxiran-2-yl]-3-methylpent-2-enoxy]-trimethylsilane |
| PubChem CID | 10633954 |
| Molecular Formula | C13H26O2Si |
| Molecular Weight | 242.43 g/mol |
| Exact Mass | 242.17 |
| IUPAC Name | [(E)-5-[(2R)-3,3-dimethyloxiran-2-yl]-3-methylpent-2-enoxy]-trimethylsilane |
| SMILES | C/C(=C\CO[Si](C)(C)C)CC[C@H]1OC1(C)C |
| InChI | InChI=1S/C13H26O2Si/c1-11(9-10-14-16(4,5)6)7-8-12-13(2,3)15-12/h9,12H,7-8,10H2,1-6H3/b11-9+/t12-/m1/s1 |
| InChIKey | GOPCXVNROXWEMI-LMMOQWNQSA-N |
| XLogP | 3.74 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.43 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze [(E)-5-[(2R)-3,3-dimethyloxiran-2-yl]-3-methylpent-2-enoxy]-trimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-5-[(2R)-3,3-dimethyloxiran-2-yl]-3-methylpent-2-enoxy]-trimethylsilane?
The IUPAC name of [(E)-5-[(2R)-3,3-dimethyloxiran-2-yl]-3-methylpent-2-enoxy]-trimethylsilane (CID 10633954) is [(E)-5-[(2R)-3,3-dimethyloxiran-2-yl]-3-methylpent-2-enoxy]-trimethylsilane.
What is the SMILES notation for [(E)-5-[(2R)-3,3-dimethyloxiran-2-yl]-3-methylpent-2-enoxy]-trimethylsilane?
The canonical SMILES for [(E)-5-[(2R)-3,3-dimethyloxiran-2-yl]-3-methylpent-2-enoxy]-trimethylsilane is C/C(=C\CO[Si](C)(C)C)CC[C@H]1OC1(C)C.
What is the InChIKey of [(E)-5-[(2R)-3,3-dimethyloxiran-2-yl]-3-methylpent-2-enoxy]-trimethylsilane?
The InChIKey is GOPCXVNROXWEMI-LMMOQWNQSA-N. The full InChI is InChI=1S/C13H26O2Si/c1-11(9-10-14-16(4,5)6)7-8-12-13(2,3)15-12/h9,12H,7-8,10H2,1-6H3/b11-9+/t12-/m1/s1.
What are the key properties of [(E)-5-[(2R)-3,3-dimethyloxiran-2-yl]-3-methylpent-2-enoxy]-trimethylsilane?
[(E)-5-[(2R)-3,3-dimethyloxiran-2-yl]-3-methylpent-2-enoxy]-trimethylsilane has a molecular weight of 242.43 g/mol, XLogP of 3.74, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-5-[(2R)-3,3-dimethyloxiran-2-yl]-3-methylpent-2-enoxy]-trimethylsilane is sourced from PubChem (CID 10633954), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).