C12H15N3O4S — CID 106339604
1-[3-(methanesulfonamido)propyl]benzimidazole-5-carboxylic acid (PubChem CID 106339604) has the molecular formula C12H15N3O4S and a molecular weight of 297.34 g/mol. Its IUPAC name is 1-[3-(methanesulfonamido)propyl]benzimidazole-5-carboxylic acid.
| Compound Name | 1-[3-(methanesulfonamido)propyl]benzimidazole-5-carboxylic acid |
|---|---|
| PubChem CID | 106339604 |
| Molecular Formula | C12H15N3O4S |
| Molecular Weight | 297.34 g/mol |
| Exact Mass | 297.08 |
| IUPAC Name | 1-[3-(methanesulfonamido)propyl]benzimidazole-5-carboxylic acid |
| SMILES | CS(=O)(=O)NCCCn1cnc2cc(C(=O)O)ccc21 |
| InChI | InChI=1S/C12H15N3O4S/c1-20(18,19)14-5-2-6-15-8-13-10-7-9(12(16)17)3-4-11(10)15/h3-4,7-8,14H,2,5-6H2,1H3,(H,16,17) |
| InChIKey | AFNVSFLXOHHGNT-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.34 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|