C8H16N2O4S — CID 106340220
(E)-4-[3-(methanesulfonamido)propylamino]but-2-enoic acid (PubChem CID 106340220) has the molecular formula C8H16N2O4S and a molecular weight of 236.29 g/mol. Its IUPAC name is (E)-4-[3-(methanesulfonamido)propylamino]but-2-enoic acid.
| Compound Name | (E)-4-[3-(methanesulfonamido)propylamino]but-2-enoic acid |
|---|---|
| PubChem CID | 106340220 |
| Molecular Formula | C8H16N2O4S |
| Molecular Weight | 236.29 g/mol |
| Exact Mass | 236.08 |
| IUPAC Name | (E)-4-[3-(methanesulfonamido)propylamino]but-2-enoic acid |
| SMILES | CS(=O)(=O)NCCCNC/C=C/C(=O)O |
| InChI | InChI=1S/C8H16N2O4S/c1-15(13,14)10-7-3-6-9-5-2-4-8(11)12/h2,4,9-10H,3,5-7H2,1H3,(H,11,12)/b4-2+ |
| InChIKey | AESUFWRTTWTGEW-DUXPYHPUSA-N |
| XLogP | -0.84 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.29 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|