C16H20O2 — CID 10634054
(1S,2S,6S,7S)-4-(4-oxocyclohexylidene)tricyclo[5.2.1.02,6]decan-8-one (PubChem CID 10634054) has the molecular formula C16H20O2 and a molecular weight of 244.33 g/mol. Its IUPAC name is (1S,2S,6S,7S)-4-(4-oxocyclohexylidene)tricyclo[5.2.1.02,6]decan-8-one.
| Compound Name | (1S,2S,6S,7S)-4-(4-oxocyclohexylidene)tricyclo[5.2.1.02,6]decan-8-one |
|---|---|
| PubChem CID | 10634054 |
| Molecular Formula | C16H20O2 |
| Molecular Weight | 244.33 g/mol |
| Exact Mass | 244.15 |
| IUPAC Name | (1S,2S,6S,7S)-4-(4-oxocyclohexylidene)tricyclo[5.2.1.02,6]decan-8-one |
| SMILES | O=C1CCC(=C2C[C@H]3[C@@H]4CC(=O)[C@@H](C4)[C@H]3C2)CC1 |
| InChI | InChI=1S/C16H20O2/c17-12-3-1-9(2-4-12)10-5-13-11-7-15(14(13)6-10)16(18)8-11/h11,13-15H,1-8H2/t11-,13-,14-,15-/m0/s1 |
| InChIKey | YHKBANIERIYRJY-MXAVVETBSA-N |
| XLogP | 3.06 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.33 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|