C13H24S2 — CID 10634074
4,4-bis(ethylsulfanyl)-3,3,5,5-tetramethylcyclopentene (PubChem CID 10634074) has the molecular formula C13H24S2 and a molecular weight of 244.47 g/mol. Its IUPAC name is 4,4-bis(ethylsulfanyl)-3,3,5,5-tetramethylcyclopentene.
| Compound Name | 4,4-bis(ethylsulfanyl)-3,3,5,5-tetramethylcyclopentene |
|---|---|
| PubChem CID | 10634074 |
| Molecular Formula | C13H24S2 |
| Molecular Weight | 244.47 g/mol |
| Exact Mass | 244.13 |
| IUPAC Name | 4,4-bis(ethylsulfanyl)-3,3,5,5-tetramethylcyclopentene |
| SMILES | CCSC1(SCC)C(C)(C)C=CC1(C)C |
| InChI | InChI=1S/C13H24S2/c1-7-14-13(15-8-2)11(3,4)9-10-12(13,5)6/h9-10H,7-8H2,1-6H3 |
| InChIKey | RLMQIBTVNILMOE-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.47 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|