C12H23N3O5S — CID 106341128
2-[2-(ethylsulfamoyl)ethylcarbamoylamino]-1-methylcyclopentane-1-carboxylic acid (PubChem CID 106341128) has the molecular formula C12H23N3O5S and a molecular weight of 321.40 g/mol. Its IUPAC name is 2-[2-(ethylsulfamoyl)ethylcarbamoylamino]-1-methylcyclopentane-1-carboxylic acid.
| Compound Name | 2-[2-(ethylsulfamoyl)ethylcarbamoylamino]-1-methylcyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 106341128 |
| Molecular Formula | C12H23N3O5S |
| Molecular Weight | 321.40 g/mol |
| Exact Mass | 321.14 |
| IUPAC Name | 2-[2-(ethylsulfamoyl)ethylcarbamoylamino]-1-methylcyclopentane-1-carboxylic acid |
| SMILES | CCNS(=O)(=O)CCNC(=O)NC1CCCC1(C)C(=O)O |
| InChI | InChI=1S/C12H23N3O5S/c1-3-14-21(19,20)8-7-13-11(18)15-9-5-4-6-12(9,2)10(16)17/h9,14H,3-8H2,1-2H3,(H,16,17)(H2,13,15,18) |
| InChIKey | ZFROUGXQGIKXLS-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 124.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.40 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |