C11H10N4O3 — CID 10634145
(5Z)-5-(8-oxo-1,5,6,7-tetrahydropyrrolo[2,3-c]azepin-4-ylidene)imidazolidine-2,4-dione (PubChem CID 10634145) has the molecular formula C11H10N4O3 and a molecular weight of 246.23 g/mol. Its IUPAC name is (5Z)-5-(8-oxo-1,5,6,7-tetrahydropyrrolo[2,3-c]azepin-4-ylidene)imidazolidine-2,4-dione.
| Compound Name | (5Z)-5-(8-oxo-1,5,6,7-tetrahydropyrrolo[2,3-c]azepin-4-ylidene)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 10634145 |
| Molecular Formula | C11H10N4O3 |
| Molecular Weight | 246.23 g/mol |
| Exact Mass | 246.08 |
| IUPAC Name | (5Z)-5-(8-oxo-1,5,6,7-tetrahydropyrrolo[2,3-c]azepin-4-ylidene)imidazolidine-2,4-dione |
| SMILES | O=C1NC(=O)/C(=C2\CCNC(=O)c3[nH]ccc32)N1 |
| InChI | InChI=1S/C11H10N4O3/c16-9-7-5(1-3-12-7)6(2-4-13-9)8-10(17)15-11(18)14-8/h1,3,12H,2,4H2,(H,13,16)(H2,14,15,17,18)/b8-6- |
| InChIKey | MOYLWFAZPQYOGQ-VURMDHGXSA-N |
| XLogP | -0.30 |
| TPSA | 103.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.23 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|