C12H16N2O4S2 — CID 106342094
5-(4-hydroxybut-1-ynyl)-N-[2-(methylsulfamoyl)ethyl]thiophene-3-carboxamide (PubChem CID 106342094) has the molecular formula C12H16N2O4S2 and a molecular weight of 316.40 g/mol. Its IUPAC name is 5-(4-hydroxybut-1-ynyl)-N-[2-(methylsulfamoyl)ethyl]thiophene-3-carboxamide.
| Compound Name | 5-(4-hydroxybut-1-ynyl)-N-[2-(methylsulfamoyl)ethyl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 106342094 |
| Molecular Formula | C12H16N2O4S2 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.06 |
| IUPAC Name | 5-(4-hydroxybut-1-ynyl)-N-[2-(methylsulfamoyl)ethyl]thiophene-3-carboxamide |
| SMILES | CNS(=O)(=O)CCNC(=O)c1csc(C#CCCO)c1 |
| InChI | InChI=1S/C12H16N2O4S2/c1-13-20(17,18)7-5-14-12(16)10-8-11(19-9-10)4-2-3-6-15/h8-9,13,15H,3,5-7H2,1H3,(H,14,16) |
| InChIKey | ASYINBBFGGTTMS-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|