C12H20N4O3S — CID 106342410
6-(ethylamino)-N-[3-(methanesulfonamido)propyl]pyridine-2-carboxamide (PubChem CID 106342410) has the molecular formula C12H20N4O3S and a molecular weight of 300.38 g/mol. Its IUPAC name is 6-(ethylamino)-N-[3-(methanesulfonamido)propyl]pyridine-2-carboxamide.
| Compound Name | 6-(ethylamino)-N-[3-(methanesulfonamido)propyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 106342410 |
| Molecular Formula | C12H20N4O3S |
| Molecular Weight | 300.38 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | 6-(ethylamino)-N-[3-(methanesulfonamido)propyl]pyridine-2-carboxamide |
| SMILES | CCNc1cccc(C(=O)NCCCNS(C)(=O)=O)n1 |
| InChI | InChI=1S/C12H20N4O3S/c1-3-13-11-7-4-6-10(16-11)12(17)14-8-5-9-15-20(2,18)19/h4,6-7,15H,3,5,8-9H2,1-2H3,(H,13,16)(H,14,17) |
| InChIKey | PHNBFGKSIQEAIR-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 100.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.38 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|