C12H21N5O2S — CID 106343137
2-[[2-cyclopropyl-6-(ethylamino)pyrimidin-4-yl]amino]-N-methylethanesulfonamide (PubChem CID 106343137) has the molecular formula C12H21N5O2S and a molecular weight of 299.40 g/mol. Its IUPAC name is 2-[[2-cyclopropyl-6-(ethylamino)pyrimidin-4-yl]amino]-N-methylethanesulfonamide.
| Compound Name | 2-[[2-cyclopropyl-6-(ethylamino)pyrimidin-4-yl]amino]-N-methylethanesulfonamide |
|---|---|
| PubChem CID | 106343137 |
| Molecular Formula | C12H21N5O2S |
| Molecular Weight | 299.40 g/mol |
| Exact Mass | 299.14 |
| IUPAC Name | 2-[[2-cyclopropyl-6-(ethylamino)pyrimidin-4-yl]amino]-N-methylethanesulfonamide |
| SMILES | CCNc1cc(NCCS(=O)(=O)NC)nc(C2CC2)n1 |
| InChI | InChI=1S/C12H21N5O2S/c1-3-14-10-8-11(15-6-7-20(18,19)13-2)17-12(16-10)9-4-5-9/h8-9,13H,3-7H2,1-2H3,(H2,14,15,16,17) |
| InChIKey | ZOQUSWYXLMIDSH-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 96.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.40 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |