C14H18O4 — CID 10634412
methyl (3S,6R,9S)-6,9-bis(ethenyl)-2-oxo-1-oxaspiro[4.4]nonane-3-carboxylate (PubChem CID 10634412) has the molecular formula C14H18O4 and a molecular weight of 250.29 g/mol. Its IUPAC name is methyl (3S,6R,9S)-6,9-bis(ethenyl)-2-oxo-1-oxaspiro[4.4]nonane-3-carboxylate.
| Compound Name | methyl (3S,6R,9S)-6,9-bis(ethenyl)-2-oxo-1-oxaspiro[4.4]nonane-3-carboxylate |
|---|---|
| PubChem CID | 10634412 |
| Molecular Formula | C14H18O4 |
| Molecular Weight | 250.29 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | methyl (3S,6R,9S)-6,9-bis(ethenyl)-2-oxo-1-oxaspiro[4.4]nonane-3-carboxylate |
| SMILES | C=C[C@@H]1CC[C@H](C=C)C12C[C@@H](C(=O)OC)C(=O)O2 |
| InChI | InChI=1S/C14H18O4/c1-4-9-6-7-10(5-2)14(9)8-11(12(15)17-3)13(16)18-14/h4-5,9-11H,1-2,6-8H2,3H3/t9-,10+,11-,14?/m0/s1 |
| InChIKey | WODFGCLOMPXSQS-JSIFYMHPSA-N |
| XLogP | 1.86 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.29 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|