C15H22O3 — CID 10634434
(3aR,5S,8bS)-5,7,7-trimethyl-1-methylidene-4,5,6,8-tetrahydrocyclopenta[e][1]benzofuran-3a,8b-diol (PubChem CID 10634434) has the molecular formula C15H22O3 and a molecular weight of 250.34 g/mol. Its IUPAC name is (3aR,5S,8bS)-5,7,7-trimethyl-1-methylidene-4,5,6,8-tetrahydrocyclopenta[e][1]benzofuran-3a,8b-diol.
| Compound Name | (3aR,5S,8bS)-5,7,7-trimethyl-1-methylidene-4,5,6,8-tetrahydrocyclopenta[e][1]benzofuran-3a,8b-diol |
|---|---|
| PubChem CID | 10634434 |
| Molecular Formula | C15H22O3 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | (3aR,5S,8bS)-5,7,7-trimethyl-1-methylidene-4,5,6,8-tetrahydrocyclopenta[e][1]benzofuran-3a,8b-diol |
| SMILES | C=C1CO[C@]2(O)C[C@H](C)C3=C(CC(C)(C)C3)[C@]12O |
| InChI | InChI=1S/C15H22O3/c1-9-5-14(16)15(17,10(2)8-18-14)12-7-13(3,4)6-11(9)12/h9,16-17H,2,5-8H2,1,3-4H3/t9-,14+,15+/m0/s1 |
| InChIKey | YFDGLOPAKONGIU-TZTCFGBESA-N |
| XLogP | 2.15 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|