C16H26O2 — CID 10634451
(1S,2S,5S,8R)-2-methoxy-4,4,8-trimethyltricyclo[6.3.1.01,5]dodecan-9-one (PubChem CID 10634451) has the molecular formula C16H26O2 and a molecular weight of 250.38 g/mol. Its IUPAC name is (1S,2S,5S,8R)-2-methoxy-4,4,8-trimethyltricyclo[6.3.1.01,5]dodecan-9-one.
| Compound Name | (1S,2S,5S,8R)-2-methoxy-4,4,8-trimethyltricyclo[6.3.1.01,5]dodecan-9-one |
|---|---|
| PubChem CID | 10634451 |
| Molecular Formula | C16H26O2 |
| Molecular Weight | 250.38 g/mol |
| Exact Mass | 250.19 |
| IUPAC Name | (1S,2S,5S,8R)-2-methoxy-4,4,8-trimethyltricyclo[6.3.1.01,5]dodecan-9-one |
| SMILES | CO[C@H]1CC(C)(C)[C@@H]2CC[C@]3(C)C[C@]12CCC3=O |
| InChI | InChI=1S/C16H26O2/c1-14(2)9-13(18-4)16-8-6-12(17)15(3,10-16)7-5-11(14)16/h11,13H,5-10H2,1-4H3/t11-,13-,15+,16-/m0/s1 |
| InChIKey | OPOZLLBXDVIYTB-YUDUHTQSSA-N |
| XLogP | 3.59 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.38 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |