About N-[(2E,4E)-hexa-2,4-dienyl]-4-methylbenzenesulfonamide
N-[(2E,4E)-hexa-2,4-dienyl]-4-methylbenzenesulfonamide (PubChem CID 10634515) has the molecular formula C13H17NO2S
and a molecular weight of 251.35 g/mol. Its IUPAC name is N-[(2E,4E)-hexa-2,4-dienyl]-4-methylbenzenesulfonamide.
Molecular Properties
| Compound Name | N-[(2E,4E)-hexa-2,4-dienyl]-4-methylbenzenesulfonamide |
| PubChem CID | 10634515 |
| Molecular Formula | C13H17NO2S |
| Molecular Weight | 251.35 g/mol |
| Exact Mass | 251.10 |
| IUPAC Name | N-[(2E,4E)-hexa-2,4-dienyl]-4-methylbenzenesulfonamide |
| SMILES | C/C=C/C=C/CNS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C13H17NO2S/c1-3-4-5-6-11-14-17(15,16)13-9-7-12(2)8-10-13/h3-10,14H,11H2,1-2H3/b4-3+,6-5+ |
| InChIKey | ZGEQTUPIMSKVDY-VNKDHWASSA-N |
| XLogP | 2.41 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.35 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-[(2E,4E)-hexa-2,4-dienyl]-4-methylbenzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2E,4E)-hexa-2,4-dienyl]-4-methylbenzenesulfonamide?
The IUPAC name of N-[(2E,4E)-hexa-2,4-dienyl]-4-methylbenzenesulfonamide (CID 10634515) is N-[(2E,4E)-hexa-2,4-dienyl]-4-methylbenzenesulfonamide.
What is the SMILES notation for N-[(2E,4E)-hexa-2,4-dienyl]-4-methylbenzenesulfonamide?
The canonical SMILES for N-[(2E,4E)-hexa-2,4-dienyl]-4-methylbenzenesulfonamide is C/C=C/C=C/CNS(=O)(=O)c1ccc(C)cc1.
What is the InChIKey of N-[(2E,4E)-hexa-2,4-dienyl]-4-methylbenzenesulfonamide?
The InChIKey is ZGEQTUPIMSKVDY-VNKDHWASSA-N. The full InChI is InChI=1S/C13H17NO2S/c1-3-4-5-6-11-14-17(15,16)13-9-7-12(2)8-10-13/h3-10,14H,11H2,1-2H3/b4-3+,6-5+.
What are the key properties of N-[(2E,4E)-hexa-2,4-dienyl]-4-methylbenzenesulfonamide?
N-[(2E,4E)-hexa-2,4-dienyl]-4-methylbenzenesulfonamide has a molecular weight of 251.35 g/mol, XLogP of 2.41, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2E,4E)-hexa-2,4-dienyl]-4-methylbenzenesulfonamide is sourced from PubChem (CID 10634515), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).