C9H18N4 — CID 106345214
3-methyl-2-N-(1H-pyrazol-5-ylmethyl)butane-1,2-diamine (PubChem CID 106345214) has the molecular formula C9H18N4 and a molecular weight of 182.27 g/mol. Its IUPAC name is 3-methyl-2-N-(1H-pyrazol-5-ylmethyl)butane-1,2-diamine.
| Compound Name | 3-methyl-2-N-(1H-pyrazol-5-ylmethyl)butane-1,2-diamine |
|---|---|
| PubChem CID | 106345214 |
| Molecular Formula | C9H18N4 |
| Molecular Weight | 182.27 g/mol |
| Exact Mass | 182.15 |
| IUPAC Name | 3-methyl-2-N-(1H-pyrazol-5-ylmethyl)butane-1,2-diamine |
| SMILES | CC(C)C(CN)NCc1ccn[nH]1 |
| InChI | InChI=1S/C9H18N4/c1-7(2)9(5-10)11-6-8-3-4-12-13-8/h3-4,7,9,11H,5-6,10H2,1-2H3,(H,12,13) |
| InChIKey | MGSLXLJLSVMGEK-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 66.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.27 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |