About 1-methyl-4-pyrrol-1-yl-3,6-dihydro-2H-pyridine
1-methyl-4-pyrrol-1-yl-3,6-dihydro-2H-pyridine (PubChem CID 10634554) has the molecular formula C10H14N2
and a molecular weight of 162.24 g/mol. Its IUPAC name is 1-methyl-4-pyrrol-1-yl-3,6-dihydro-2H-pyridine.
Molecular Properties
| Compound Name | 1-methyl-4-pyrrol-1-yl-3,6-dihydro-2H-pyridine |
| PubChem CID | 10634554 |
| Molecular Formula | C10H14N2 |
| Molecular Weight | 162.24 g/mol |
| Exact Mass | 162.12 |
| IUPAC Name | 1-methyl-4-pyrrol-1-yl-3,6-dihydro-2H-pyridine |
| SMILES | CN1CC=C(n2cccc2)CC1 |
| InChI | InChI=1S/C10H14N2/c1-11-8-4-10(5-9-11)12-6-2-3-7-12/h2-4,6-7H,5,8-9H2,1H3 |
| InChIKey | YEALXOCXZYSTQC-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.24 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-methyl-4-pyrrol-1-yl-3,6-dihydro-2H-pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-4-pyrrol-1-yl-3,6-dihydro-2H-pyridine?
The IUPAC name of 1-methyl-4-pyrrol-1-yl-3,6-dihydro-2H-pyridine (CID 10634554) is 1-methyl-4-pyrrol-1-yl-3,6-dihydro-2H-pyridine.
What is the SMILES notation for 1-methyl-4-pyrrol-1-yl-3,6-dihydro-2H-pyridine?
The canonical SMILES for 1-methyl-4-pyrrol-1-yl-3,6-dihydro-2H-pyridine is CN1CC=C(n2cccc2)CC1.
What is the InChIKey of 1-methyl-4-pyrrol-1-yl-3,6-dihydro-2H-pyridine?
The InChIKey is YEALXOCXZYSTQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2/c1-11-8-4-10(5-9-11)12-6-2-3-7-12/h2-4,6-7H,5,8-9H2,1H3.
What are the key properties of 1-methyl-4-pyrrol-1-yl-3,6-dihydro-2H-pyridine?
1-methyl-4-pyrrol-1-yl-3,6-dihydro-2H-pyridine has a molecular weight of 162.24 g/mol, XLogP of 1.66, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-4-pyrrol-1-yl-3,6-dihydro-2H-pyridine is sourced from PubChem (CID 10634554), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).