C13H15F3N2O3 — CID 106345777
2-[(1-amino-3-methyl-1-oxobutan-2-yl)amino]-5-(trifluoromethyl)benzoic acid (PubChem CID 106345777) has the molecular formula C13H15F3N2O3 and a molecular weight of 304.27 g/mol. Its IUPAC name is 2-[(1-amino-3-methyl-1-oxobutan-2-yl)amino]-5-(trifluoromethyl)benzoic acid.
| Compound Name | 2-[(1-amino-3-methyl-1-oxobutan-2-yl)amino]-5-(trifluoromethyl)benzoic acid |
|---|---|
| PubChem CID | 106345777 |
| Molecular Formula | C13H15F3N2O3 |
| Molecular Weight | 304.27 g/mol |
| Exact Mass | 304.10 |
| IUPAC Name | 2-[(1-amino-3-methyl-1-oxobutan-2-yl)amino]-5-(trifluoromethyl)benzoic acid |
| SMILES | CC(C)C(Nc1ccc(C(F)(F)F)cc1C(=O)O)C(N)=O |
| InChI | InChI=1S/C13H15F3N2O3/c1-6(2)10(11(17)19)18-9-4-3-7(13(14,15)16)5-8(9)12(20)21/h3-6,10,18H,1-2H3,(H2,17,19)(H,20,21) |
| InChIKey | RYXWPBSTEYAFKM-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.27 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |