About [4-[(2R,5S)-3-formyl-5-methoxy-2,5-dihydrofuran-2-yl]-2-methylidenebutyl] acetate
[4-[(2R,5S)-3-formyl-5-methoxy-2,5-dihydrofuran-2-yl]-2-methylidenebutyl] acetate (PubChem CID 10634672) has the molecular formula C13H18O5
and a molecular weight of 254.28 g/mol. Its IUPAC name is [4-[(2R,5S)-3-formyl-5-methoxy-2,5-dihydrofuran-2-yl]-2-methylidenebutyl] acetate.
Molecular Properties
| Compound Name | [4-[(2R,5S)-3-formyl-5-methoxy-2,5-dihydrofuran-2-yl]-2-methylidenebutyl] acetate |
| PubChem CID | 10634672 |
| Molecular Formula | C13H18O5 |
| Molecular Weight | 254.28 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | [4-[(2R,5S)-3-formyl-5-methoxy-2,5-dihydrofuran-2-yl]-2-methylidenebutyl] acetate |
| SMILES | C=C(CC[C@H]1O[C@H](OC)C=C1C=O)COC(C)=O |
| InChI | InChI=1S/C13H18O5/c1-9(8-17-10(2)15)4-5-12-11(7-14)6-13(16-3)18-12/h6-7,12-13H,1,4-5,8H2,2-3H3/t12-,13+/m1/s1 |
| InChIKey | SPWCLZFFGVKAEI-OLZOCXBDSA-N |
| XLogP | 1.38 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.28 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [4-[(2R,5S)-3-formyl-5-methoxy-2,5-dihydrofuran-2-yl]-2-methylidenebutyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[(2R,5S)-3-formyl-5-methoxy-2,5-dihydrofuran-2-yl]-2-methylidenebutyl] acetate?
The IUPAC name of [4-[(2R,5S)-3-formyl-5-methoxy-2,5-dihydrofuran-2-yl]-2-methylidenebutyl] acetate (CID 10634672) is [4-[(2R,5S)-3-formyl-5-methoxy-2,5-dihydrofuran-2-yl]-2-methylidenebutyl] acetate.
What is the SMILES notation for [4-[(2R,5S)-3-formyl-5-methoxy-2,5-dihydrofuran-2-yl]-2-methylidenebutyl] acetate?
The canonical SMILES for [4-[(2R,5S)-3-formyl-5-methoxy-2,5-dihydrofuran-2-yl]-2-methylidenebutyl] acetate is C=C(CC[C@H]1O[C@H](OC)C=C1C=O)COC(C)=O.
What is the InChIKey of [4-[(2R,5S)-3-formyl-5-methoxy-2,5-dihydrofuran-2-yl]-2-methylidenebutyl] acetate?
The InChIKey is SPWCLZFFGVKAEI-OLZOCXBDSA-N. The full InChI is InChI=1S/C13H18O5/c1-9(8-17-10(2)15)4-5-12-11(7-14)6-13(16-3)18-12/h6-7,12-13H,1,4-5,8H2,2-3H3/t12-,13+/m1/s1.
What are the key properties of [4-[(2R,5S)-3-formyl-5-methoxy-2,5-dihydrofuran-2-yl]-2-methylidenebutyl] acetate?
[4-[(2R,5S)-3-formyl-5-methoxy-2,5-dihydrofuran-2-yl]-2-methylidenebutyl] acetate has a molecular weight of 254.28 g/mol, XLogP of 1.38, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[(2R,5S)-3-formyl-5-methoxy-2,5-dihydrofuran-2-yl]-2-methylidenebutyl] acetate is sourced from PubChem (CID 10634672), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).