C16H14O3 — CID 10634677
12-ethoxy-11,14-dioxatetracyclo[7.6.1.05,16.010,15]hexadeca-1,3,5(16),6,8,10(15)-hexaene (PubChem CID 10634677) has the molecular formula C16H14O3 and a molecular weight of 254.28 g/mol. Its IUPAC name is 12-ethoxy-11,14-dioxatetracyclo[7.6.1.05,16.010,15]hexadeca-1,3,5(16),6,8,10(15)-hexaene.
| Compound Name | 12-ethoxy-11,14-dioxatetracyclo[7.6.1.05,16.010,15]hexadeca-1,3,5(16),6,8,10(15)-hexaene |
|---|---|
| PubChem CID | 10634677 |
| Molecular Formula | C16H14O3 |
| Molecular Weight | 254.28 g/mol |
| Exact Mass | 254.09 |
| IUPAC Name | 12-ethoxy-11,14-dioxatetracyclo[7.6.1.05,16.010,15]hexadeca-1,3,5(16),6,8,10(15)-hexaene |
| SMILES | CCOC1COC2=C(O1)c1cccc3cccc2c13 |
| InChI | InChI=1S/C16H14O3/c1-2-17-13-9-18-15-11-7-3-5-10-6-4-8-12(14(10)11)16(15)19-13/h3-8,13H,2,9H2,1H3 |
| InChIKey | GAKOIXVDTIAXAF-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.28 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |