About 4-(3-fluorophenyl)-2,2-dimethylchromene
4-(3-fluorophenyl)-2,2-dimethylchromene (PubChem CID 10634686) has the molecular formula C17H15FO
and a molecular weight of 254.30 g/mol. Its IUPAC name is 4-(3-fluorophenyl)-2,2-dimethylchromene.
Molecular Properties
| Compound Name | 4-(3-fluorophenyl)-2,2-dimethylchromene |
| PubChem CID | 10634686 |
| Molecular Formula | C17H15FO |
| Molecular Weight | 254.30 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | 4-(3-fluorophenyl)-2,2-dimethylchromene |
| SMILES | CC1(C)C=C(c2cccc(F)c2)c2ccccc2O1 |
| InChI | InChI=1S/C17H15FO/c1-17(2)11-15(12-6-5-7-13(18)10-12)14-8-3-4-9-16(14)19-17/h3-11H,1-2H3 |
| InChIKey | DSQIQYBXNTUHFK-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.30 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-(3-fluorophenyl)-2,2-dimethylchromene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3-fluorophenyl)-2,2-dimethylchromene?
The IUPAC name of 4-(3-fluorophenyl)-2,2-dimethylchromene (CID 10634686) is 4-(3-fluorophenyl)-2,2-dimethylchromene.
What is the SMILES notation for 4-(3-fluorophenyl)-2,2-dimethylchromene?
The canonical SMILES for 4-(3-fluorophenyl)-2,2-dimethylchromene is CC1(C)C=C(c2cccc(F)c2)c2ccccc2O1.
What is the InChIKey of 4-(3-fluorophenyl)-2,2-dimethylchromene?
The InChIKey is DSQIQYBXNTUHFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15FO/c1-17(2)11-15(12-6-5-7-13(18)10-12)14-8-3-4-9-16(14)19-17/h3-11H,1-2H3.
What are the key properties of 4-(3-fluorophenyl)-2,2-dimethylchromene?
4-(3-fluorophenyl)-2,2-dimethylchromene has a molecular weight of 254.30 g/mol, XLogP of 4.43, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-fluorophenyl)-2,2-dimethylchromene is sourced from PubChem (CID 10634686), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).