C14H22O4 — CID 10634701
1-[(1S,2R,6S,7R,9R)-4,4-dimethyl-3,5,8-trioxatricyclo[5.2.1.02,6]decan-9-yl]-3-methylbutan-1-one (PubChem CID 10634701) has the molecular formula C14H22O4 and a molecular weight of 254.33 g/mol. Its IUPAC name is 1-[(1S,2R,6S,7R,9R)-4,4-dimethyl-3,5,8-trioxatricyclo[5.2.1.02,6]decan-9-yl]-3-methylbutan-1-one.
| Compound Name | 1-[(1S,2R,6S,7R,9R)-4,4-dimethyl-3,5,8-trioxatricyclo[5.2.1.02,6]decan-9-yl]-3-methylbutan-1-one |
|---|---|
| PubChem CID | 10634701 |
| Molecular Formula | C14H22O4 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | 1-[(1S,2R,6S,7R,9R)-4,4-dimethyl-3,5,8-trioxatricyclo[5.2.1.02,6]decan-9-yl]-3-methylbutan-1-one |
| SMILES | CC(C)CC(=O)[C@@H]1O[C@@H]2C[C@H]1[C@H]1OC(C)(C)O[C@H]12 |
| InChI | InChI=1S/C14H22O4/c1-7(2)5-9(15)11-8-6-10(16-11)13-12(8)17-14(3,4)18-13/h7-8,10-13H,5-6H2,1-4H3/t8-,10-,11-,12-,13+/m1/s1 |
| InChIKey | IPMJCAOWXUSIMS-WECGXBHGSA-N |
| XLogP | 1.91 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |