C7H14N6O — CID 106347371
2-[(5-amino-1H-1,2,4-triazol-3-yl)amino]-3-methylbutanamide (PubChem CID 106347371) has the molecular formula C7H14N6O and a molecular weight of 198.23 g/mol. Its IUPAC name is 2-[(5-amino-1H-1,2,4-triazol-3-yl)amino]-3-methylbutanamide.
| Compound Name | 2-[(5-amino-1H-1,2,4-triazol-3-yl)amino]-3-methylbutanamide |
|---|---|
| PubChem CID | 106347371 |
| Molecular Formula | C7H14N6O |
| Molecular Weight | 198.23 g/mol |
| Exact Mass | 198.12 |
| IUPAC Name | 2-[(5-amino-1H-1,2,4-triazol-3-yl)amino]-3-methylbutanamide |
| SMILES | CC(C)C(Nc1n[nH]c(N)n1)C(N)=O |
| InChI | InChI=1S/C7H14N6O/c1-3(2)4(5(8)14)10-7-11-6(9)12-13-7/h3-4H,1-2H3,(H2,8,14)(H4,9,10,11,12,13) |
| InChIKey | VKSZYSYUQKUHKR-UHFFFAOYSA-N |
| XLogP | -0.69 |
| TPSA | 122.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.23 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |