C11H17N5O3 — CID 106347453
3-methyl-2-[[6-(methylamino)-3-nitro-2-pyridinyl]amino]butanamide (PubChem CID 106347453) has the molecular formula C11H17N5O3 and a molecular weight of 267.29 g/mol. Its IUPAC name is 3-methyl-2-[[6-(methylamino)-3-nitro-2-pyridinyl]amino]butanamide.
| Compound Name | 3-methyl-2-[[6-(methylamino)-3-nitro-2-pyridinyl]amino]butanamide |
|---|---|
| PubChem CID | 106347453 |
| Molecular Formula | C11H17N5O3 |
| Molecular Weight | 267.29 g/mol |
| Exact Mass | 267.13 |
| IUPAC Name | 3-methyl-2-[[6-(methylamino)-3-nitro-2-pyridinyl]amino]butanamide |
| SMILES | CNc1ccc([N+](=O)[O-])c(NC(C(N)=O)C(C)C)n1 |
| InChI | InChI=1S/C11H17N5O3/c1-6(2)9(10(12)17)15-11-7(16(18)19)4-5-8(13-3)14-11/h4-6,9H,1-3H3,(H2,12,17)(H2,13,14,15) |
| InChIKey | ITXVXDHFESHMFR-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 123.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.29 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|