C13H23N5O2 — CID 106347563
2-[[6-(ethylamino)-2-(methoxymethyl)pyrimidin-4-yl]amino]-3-methylbutanamide (PubChem CID 106347563) has the molecular formula C13H23N5O2 and a molecular weight of 281.36 g/mol. Its IUPAC name is 2-[[6-(ethylamino)-2-(methoxymethyl)pyrimidin-4-yl]amino]-3-methylbutanamide.
| Compound Name | 2-[[6-(ethylamino)-2-(methoxymethyl)pyrimidin-4-yl]amino]-3-methylbutanamide |
|---|---|
| PubChem CID | 106347563 |
| Molecular Formula | C13H23N5O2 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.19 |
| IUPAC Name | 2-[[6-(ethylamino)-2-(methoxymethyl)pyrimidin-4-yl]amino]-3-methylbutanamide |
| SMILES | CCNc1cc(NC(C(N)=O)C(C)C)nc(COC)n1 |
| InChI | InChI=1S/C13H23N5O2/c1-5-15-9-6-10(17-11(16-9)7-20-4)18-12(8(2)3)13(14)19/h6,8,12H,5,7H2,1-4H3,(H2,14,19)(H2,15,16,17,18) |
| InChIKey | HTWMUDRLJWCBQB-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 102.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |