C14H23FN2O — CID 106348410
3-(2-amino-4-fluoro-5-methylanilino)-4,4-dimethylpentan-1-ol (PubChem CID 106348410) has the molecular formula C14H23FN2O and a molecular weight of 254.35 g/mol. Its IUPAC name is 3-(2-amino-4-fluoro-5-methylanilino)-4,4-dimethylpentan-1-ol.
| Compound Name | 3-(2-amino-4-fluoro-5-methylanilino)-4,4-dimethylpentan-1-ol |
|---|---|
| PubChem CID | 106348410 |
| Molecular Formula | C14H23FN2O |
| Molecular Weight | 254.35 g/mol |
| Exact Mass | 254.18 |
| IUPAC Name | 3-(2-amino-4-fluoro-5-methylanilino)-4,4-dimethylpentan-1-ol |
| SMILES | Cc1cc(NC(CCO)C(C)(C)C)c(N)cc1F |
| InChI | InChI=1S/C14H23FN2O/c1-9-7-12(11(16)8-10(9)15)17-13(5-6-18)14(2,3)4/h7-8,13,17-18H,5-6,16H2,1-4H3 |
| InChIKey | YXOCIEKSCMOVFV-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.35 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|