C15H26N2O2 — CID 106348438
3-(4-amino-3-ethoxyanilino)-4,4-dimethylpentan-1-ol (PubChem CID 106348438) has the molecular formula C15H26N2O2 and a molecular weight of 266.38 g/mol. Its IUPAC name is 3-(4-amino-3-ethoxyanilino)-4,4-dimethylpentan-1-ol.
| Compound Name | 3-(4-amino-3-ethoxyanilino)-4,4-dimethylpentan-1-ol |
|---|---|
| PubChem CID | 106348438 |
| Molecular Formula | C15H26N2O2 |
| Molecular Weight | 266.38 g/mol |
| Exact Mass | 266.20 |
| IUPAC Name | 3-(4-amino-3-ethoxyanilino)-4,4-dimethylpentan-1-ol |
| SMILES | CCOc1cc(NC(CCO)C(C)(C)C)ccc1N |
| InChI | InChI=1S/C15H26N2O2/c1-5-19-13-10-11(6-7-12(13)16)17-14(8-9-18)15(2,3)4/h6-7,10,14,17-18H,5,8-9,16H2,1-4H3 |
| InChIKey | KTABAZUPFJPAKK-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.38 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|