About 5-(1,3-benzodioxol-5-yl)-6-ethylpyrimidine-2,4-diamine
5-(1,3-benzodioxol-5-yl)-6-ethylpyrimidine-2,4-diamine (PubChem CID 10634938) has the molecular formula C13H14N4O2
and a molecular weight of 258.28 g/mol. Its IUPAC name is 5-(1,3-benzodioxol-5-yl)-6-ethylpyrimidine-2,4-diamine.
Molecular Properties
| Compound Name | 5-(1,3-benzodioxol-5-yl)-6-ethylpyrimidine-2,4-diamine |
| PubChem CID | 10634938 |
| Molecular Formula | C13H14N4O2 |
| Molecular Weight | 258.28 g/mol |
| Exact Mass | 258.11 |
| IUPAC Name | 5-(1,3-benzodioxol-5-yl)-6-ethylpyrimidine-2,4-diamine |
| SMILES | CCc1nc(N)nc(N)c1-c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C13H14N4O2/c1-2-8-11(12(14)17-13(15)16-8)7-3-4-9-10(5-7)19-6-18-9/h3-5H,2,6H2,1H3,(H4,14,15,16,17) |
| InChIKey | PHDBSFMHZZSTHJ-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 96.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.28 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-(1,3-benzodioxol-5-yl)-6-ethylpyrimidine-2,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(1,3-benzodioxol-5-yl)-6-ethylpyrimidine-2,4-diamine?
The IUPAC name of 5-(1,3-benzodioxol-5-yl)-6-ethylpyrimidine-2,4-diamine (CID 10634938) is 5-(1,3-benzodioxol-5-yl)-6-ethylpyrimidine-2,4-diamine.
What is the SMILES notation for 5-(1,3-benzodioxol-5-yl)-6-ethylpyrimidine-2,4-diamine?
The canonical SMILES for 5-(1,3-benzodioxol-5-yl)-6-ethylpyrimidine-2,4-diamine is CCc1nc(N)nc(N)c1-c1ccc2c(c1)OCO2.
What is the InChIKey of 5-(1,3-benzodioxol-5-yl)-6-ethylpyrimidine-2,4-diamine?
The InChIKey is PHDBSFMHZZSTHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14N4O2/c1-2-8-11(12(14)17-13(15)16-8)7-3-4-9-10(5-7)19-6-18-9/h3-5H,2,6H2,1H3,(H4,14,15,16,17).
What are the key properties of 5-(1,3-benzodioxol-5-yl)-6-ethylpyrimidine-2,4-diamine?
5-(1,3-benzodioxol-5-yl)-6-ethylpyrimidine-2,4-diamine has a molecular weight of 258.28 g/mol, XLogP of 1.60, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(1,3-benzodioxol-5-yl)-6-ethylpyrimidine-2,4-diamine is sourced from PubChem (CID 10634938), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).